Anthracene,1,2,3,4,5,6,7,8-octahydro-1,1,4,4,5,5,8,8-octamethyl- CAS NO.22306-30-5

The Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl-, with the CAS registry number of 22306-30-5, is also known as 1, 2, 3, 4, 5, 6, 7, 8-Octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethylanthracene. This chemical's molecular formula is C₂₂H₃₄ and molecular weight is 298.51. What's more, its IUPAC name is 1, 1, 4, 4, 5, 5, 8, 8-Octamethyl-2, 3, 6, 7-tetrahydroanthracene. 

Physical properties about Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl- are: (1)ACD/LogP: 9.72; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 0 Å²; (7)Index of Refraction: 1.488; (8)Molar Refractivity: 97.11 cm³; (9)Molar Volume: 336.7 cm³; (10)Polarizability: 38.49×10^-24 cm³; (11)Surface Tension: 30.5 dyne/cm; (12)Density: 0.886 g/cm³; (13)Flash Point: 162.1 °C; (14)Enthalpy of Vaporization: 56.54 kJ/mol; (15)Boiling Point: 344.7 °C at 760 mmHg; (16)Vapour Pressure: 0.000129 mmHg at 25 °C.

Preparation of Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl-: this chemical is prepared by reaction of 2-Chloro-2-methyl-propane with Benzene. The reaction needs reagent AlCl₃ and solvent CH₂C_l2. The reaction time is 3 hours with reaction temperature of -10 °C. The yield is about 61%.

When you are using this chemical, please be cautious about it as the following: 
As a chemical, it is irritating to eyes, respiratory system and skin. During using it, wear suitable protective clothing, gloves and eye/face protection. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.

You can still convert the following data into molecular structure: 
(1) SMILES: c12cc3c(cc1C(C)(C)CCC2(C)C)C(CCC3(C)C)(C)C
(2) InChI: InChI=1/C22H34/c1-19(2)9-10-20(3,4)16-14-18-17(13-15(16)19)21(5,6)11-12-22(18,7)8/h13-14H,9-12H2,1-8H3
(3) InChIKey: NABKENULMAEYJW-UHFFFAOYAW

The Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl-, with the CAS registry number of 22306-30-5, is also known as 1, 2, 3, 4, 5, 6, 7, 8-Octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethylanthracene. This chemical's molecular formula is C₂₂H₃₄ and molecular weight is 298.51. What's more, its IUPAC name is 1, 1, 4, 4, 5, 5, 8, 8-Octamethyl-2, 3, 6, 7-tetrahydroanthracene. 

Physical properties about Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl- are: (1)ACD/LogP: 9.72; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 0 Å²; (7)Index of Refraction: 1.488; (8)Molar Refractivity: 97.11 cm³; (9)Molar Volume: 336.7 cm³; (10)Polarizability: 38.49×10^-24 cm³; (11)Surface Tension: 30.5 dyne/cm; (12)Density: 0.886 g/cm³; (13)Flash Point: 162.1 °C; (14)Enthalpy of Vaporization: 56.54 kJ/mol; (15)Boiling Point: 344.7 °C at 760 mmHg; (16)Vapour Pressure: 0.000129 mmHg at 25 °C.

Preparation of Anthracene, 1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 1, 4, 4, 5, 5, 8, 8-octamethyl-: this chemical is prepared by reaction of 2-Chloro-2-methyl-propane with Benzene. The reaction needs reagent AlCl₃ and solvent CH₂C_l2. The reaction time is 3 hours with reaction temperature of -10 °C. The yield is about 61%.

When you are using this chemical, please be cautious about it as the following: 
As a chemical, it is irritating to eyes, respiratory system and skin. During using it, wear suitable protective clothing, gloves and eye/face protection. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.

You can still convert the following data into molecular structure: 
(1) SMILES: c12cc3c(cc1C(C)(C)CCC2(C)C)C(CCC3(C)C)(C)C
(2) InChI: InChI=1/C22H34/c1-19(2)9-10-20(3,4)16-14-18-17(13-15(16)19)21(5,6)11-12-22(18,7)8/h13-14H,9-12H2,1-8H3
(3) InChIKey: NABKENULMAEYJW-UHFFFAOYAW